About CID 175374253
CID 175374253 (PubChem CID 175374253) has the molecular formula C6H5AlF6NO2
and a molecular weight of 264.08 g/mol.
Molecular Properties
| Compound Name | CID 175374253 |
| PubChem CID | 175374253 |
| Molecular Formula | C6H5AlF6NO2 |
| Molecular Weight | 264.08 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | — |
| SMILES | FC(F)(F)[Al]C(F)(F)F.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.2CF3.Al/c6-3-1-2-4(7)5-3;2*2-1(3)4;/h1-2H2,(H,5,6,7);;; |
| InChIKey | QNAFONHJDOSKSD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.08 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 175374253 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175374253?
The IUPAC name of CID 175374253 (CID 175374253) is not available.
What is the SMILES notation for CID 175374253?
The canonical SMILES for CID 175374253 is FC(F)(F)[Al]C(F)(F)F.O=C1CCC(=O)N1.
What is the InChIKey of CID 175374253?
The InChIKey is QNAFONHJDOSKSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.2CF3.Al/c6-3-1-2-4(7)5-3;2*2-1(3)4;/h1-2H2,(H,5,6,7);;;.
What are the key properties of CID 175374253?
CID 175374253 has a molecular weight of 264.08 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175374253 is sourced from PubChem (CID 175374253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).