C9H11N3OS — CID 175374536
5-(4,5-dimethylfuran-2-yl)-2,3-dihydro-1H-1,2,4-triazole-3-carbothialdehyde (PubChem CID 175374536) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 5-(4,5-dimethylfuran-2-yl)-2,3-dihydro-1H-1,2,4-triazole-3-carbothialdehyde.
| Compound Name | 5-(4,5-dimethylfuran-2-yl)-2,3-dihydro-1H-1,2,4-triazole-3-carbothialdehyde |
|---|---|
| PubChem CID | 175374536 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 5-(4,5-dimethylfuran-2-yl)-2,3-dihydro-1H-1,2,4-triazole-3-carbothialdehyde |
| SMILES | Cc1cc(C2=NC(C=S)NN2)oc1C |
| InChI | InChI=1S/C9H11N3OS/c1-5-3-7(13-6(5)2)9-10-8(4-14)11-12-9/h3-4,8,11H,1-2H3,(H,10,12) |
| InChIKey | LBHSSTNFGSQMOJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|