About (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate
(6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate (PubChem CID 175375194) has the molecular formula C13H17ClN2O2
and a molecular weight of 268.74 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate |
| PubChem CID | 175375194 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate |
| SMILES | CCN1CCC(C(=O)Oc2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-2-16-7-5-10(6-8-16)13(17)18-11-3-4-12(14)15-9-11/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | DBOOGBZDCIHCPJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate?
The IUPAC name of (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate (CID 175375194) is (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate.
What is the SMILES notation for (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate?
The canonical SMILES for (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate is CCN1CCC(C(=O)Oc2ccc(Cl)nc2)CC1.
What is the InChIKey of (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate?
The InChIKey is DBOOGBZDCIHCPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O2/c1-2-16-7-5-10(6-8-16)13(17)18-11-3-4-12(14)15-9-11/h3-4,9-10H,2,5-8H2,1H3.
What are the key properties of (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate?
(6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate has a molecular weight of 268.74 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3-pyridinyl) 1-ethylpiperidine-4-carboxylate is sourced from PubChem (CID 175375194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).