About 5-oxohexan-2-yl carbamate
5-oxohexan-2-yl carbamate (PubChem CID 175375873) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is 5-oxohexan-2-yl carbamate.
Molecular Properties
| Compound Name | 5-oxohexan-2-yl carbamate |
| PubChem CID | 175375873 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 5-oxohexan-2-yl carbamate |
| SMILES | CC(=O)CCC(C)OC(N)=O |
| InChI | InChI=1S/C7H13NO3/c1-5(9)3-4-6(2)11-7(8)10/h6H,3-4H2,1-2H3,(H2,8,10) |
| InChIKey | QFYODFIGPLGQFY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-oxohexan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxohexan-2-yl carbamate?
The IUPAC name of 5-oxohexan-2-yl carbamate (CID 175375873) is 5-oxohexan-2-yl carbamate.
What is the SMILES notation for 5-oxohexan-2-yl carbamate?
The canonical SMILES for 5-oxohexan-2-yl carbamate is CC(=O)CCC(C)OC(N)=O.
What is the InChIKey of 5-oxohexan-2-yl carbamate?
The InChIKey is QFYODFIGPLGQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-5(9)3-4-6(2)11-7(8)10/h6H,3-4H2,1-2H3,(H2,8,10).
What are the key properties of 5-oxohexan-2-yl carbamate?
5-oxohexan-2-yl carbamate has a molecular weight of 159.18 g/mol, XLogP of 0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxohexan-2-yl carbamate is sourced from PubChem (CID 175375873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).