About 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline
3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline (PubChem CID 175376241) has the molecular formula C14H11FN2S
and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline.
Molecular Properties
| Compound Name | 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline |
| PubChem CID | 175376241 |
| Molecular Formula | C14H11FN2S |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline |
| SMILES | Nc1ccc(Cc2ccnc3ccsc23)c(F)c1 |
| InChI | InChI=1S/C14H11FN2S/c15-12-8-11(16)2-1-9(12)7-10-3-5-17-13-4-6-18-14(10)13/h1-6,8H,7,16H2 |
| InChIKey | YEMGXQPMBRITGN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline?
The IUPAC name of 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline (CID 175376241) is 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline.
What is the SMILES notation for 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline?
The canonical SMILES for 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline is Nc1ccc(Cc2ccnc3ccsc23)c(F)c1.
What is the InChIKey of 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline?
The InChIKey is YEMGXQPMBRITGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN2S/c15-12-8-11(16)2-1-9(12)7-10-3-5-17-13-4-6-18-14(10)13/h1-6,8H,7,16H2.
What are the key properties of 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline?
3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline has a molecular weight of 258.32 g/mol, XLogP of 3.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-(thieno[3,2-b]pyridin-7-ylmethyl)aniline is sourced from PubChem (CID 175376241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).