About 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium
2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium (PubChem CID 175376617) has the molecular formula C19H25Hf-
and a molecular weight of 431.90 g/mol. Its IUPAC name is 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium.
Molecular Properties
| Compound Name | 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium |
| PubChem CID | 175376617 |
| Molecular Formula | C19H25Hf- |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium |
| SMILES | CCCCC[c-]1ccc2cc3c(cc21)CC(C)(C)C3.[Hf] |
| InChI | InChI=1S/C19H25.Hf/c1-4-5-6-7-14-8-9-15-10-16-12-19(2,3)13-17(16)11-18(14)15;/h8-11H,4-7,12-13H2,1-3H3;/q-1; |
| InChIKey | ATLLKZHZGBJBNG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium?
The IUPAC name of 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium (CID 175376617) is 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium.
What is the SMILES notation for 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium?
The canonical SMILES for 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium is CCCCC[c-]1ccc2cc3c(cc21)CC(C)(C)C3.[Hf].
What is the InChIKey of 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium?
The InChIKey is ATLLKZHZGBJBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25.Hf/c1-4-5-6-7-14-8-9-15-10-16-12-19(2,3)13-17(16)11-18(14)15;/h8-11H,4-7,12-13H2,1-3H3;/q-1;.
What are the key properties of 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium?
2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium has a molecular weight of 431.90 g/mol, XLogP of 5.41, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-pentyl-1,3-dihydro-s-indacen-5-ide;hafnium is sourced from PubChem (CID 175376617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).