About 1,2-benzoxazocin-6-one
1,2-benzoxazocin-6-one (PubChem CID 175376983) has the molecular formula C10H7NO2
and a molecular weight of 173.17 g/mol. Its IUPAC name is 1,2-benzoxazocin-6-one.
Molecular Properties
| Compound Name | 1,2-benzoxazocin-6-one |
| PubChem CID | 175376983 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 1,2-benzoxazocin-6-one |
| SMILES | O=C1C=CC=NOc2ccccc21 |
| InChI | InChI=1S/C10H7NO2/c12-9-5-3-7-11-13-10-6-2-1-4-8(9)10/h1-7H |
| InChIKey | GFGVHCWDWPVZAX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-benzoxazocin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzoxazocin-6-one?
The IUPAC name of 1,2-benzoxazocin-6-one (CID 175376983) is 1,2-benzoxazocin-6-one.
What is the SMILES notation for 1,2-benzoxazocin-6-one?
The canonical SMILES for 1,2-benzoxazocin-6-one is O=C1C=CC=NOc2ccccc21.
What is the InChIKey of 1,2-benzoxazocin-6-one?
The InChIKey is GFGVHCWDWPVZAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2/c12-9-5-3-7-11-13-10-6-2-1-4-8(9)10/h1-7H.
What are the key properties of 1,2-benzoxazocin-6-one?
1,2-benzoxazocin-6-one has a molecular weight of 173.17 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzoxazocin-6-one is sourced from PubChem (CID 175376983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).