About 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride
2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride (PubChem CID 175377016) has the molecular formula C6H11ClF2N2O
and a molecular weight of 200.62 g/mol. Its IUPAC name is 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride |
| PubChem CID | 175377016 |
| Molecular Formula | C6H11ClF2N2O |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride |
| SMILES | Cl.NC(=O)CC1CNCC1(F)F |
| InChI | InChI=1S/C6H10F2N2O.ClH/c7-6(8)3-10-2-4(6)1-5(9)11;/h4,10H,1-3H2,(H2,9,11);1H |
| InChIKey | IXTXHGWIUYBIKQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride?
The IUPAC name of 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride (CID 175377016) is 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride.
What is the SMILES notation for 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride?
The canonical SMILES for 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride is Cl.NC(=O)CC1CNCC1(F)F.
What is the InChIKey of 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride?
The InChIKey is IXTXHGWIUYBIKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N2O.ClH/c7-6(8)3-10-2-4(6)1-5(9)11;/h4,10H,1-3H2,(H2,9,11);1H.
What are the key properties of 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride?
2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride has a molecular weight of 200.62 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoropyrrolidin-3-yl)acetamide;hydrochloride is sourced from PubChem (CID 175377016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).