About CID 175377072
CID 175377072 (PubChem CID 175377072) has the molecular formula C10H11Sn
and a molecular weight of 249.91 g/mol.
Molecular Properties
| Compound Name | CID 175377072 |
| PubChem CID | 175377072 |
| Molecular Formula | C10H11Sn |
| Molecular Weight | 249.91 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1C1([Sn])CC1 |
| InChI | InChI=1S/C10H11.Sn/c1-8-4-2-3-5-10(8)9-6-7-9;/h2-5H,6-7H2,1H3; |
| InChIKey | GNWPSFZTWXOAFQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.91 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 175377072 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175377072?
The IUPAC name of CID 175377072 (CID 175377072) is not available.
What is the SMILES notation for CID 175377072?
The canonical SMILES for CID 175377072 is Cc1ccccc1C1([Sn])CC1.
What is the InChIKey of CID 175377072?
The InChIKey is GNWPSFZTWXOAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11.Sn/c1-8-4-2-3-5-10(8)9-6-7-9;/h2-5H,6-7H2,1H3;.
What are the key properties of CID 175377072?
CID 175377072 has a molecular weight of 249.91 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175377072 is sourced from PubChem (CID 175377072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).