About 1-phenylphenanthrene;pyrazine
1-phenylphenanthrene;pyrazine (PubChem CID 175377735) has the molecular formula C24H18N2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-phenylphenanthrene;pyrazine.
Molecular Properties
| Compound Name | 1-phenylphenanthrene;pyrazine |
| PubChem CID | 175377735 |
| Molecular Formula | C24H18N2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-phenylphenanthrene;pyrazine |
| SMILES | c1ccc(-c2cccc3c2ccc2ccccc23)cc1.c1cnccn1 |
| InChI | InChI=1S/C20H14.C4H4N2/c1-2-7-15(8-3-1)18-11-6-12-19-17-10-5-4-9-16(17)13-14-20(18)19;1-2-6-4-3-5-1/h1-14H;1-4H |
| InChIKey | YEUWAOFWTBQGHR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylphenanthrene;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylphenanthrene;pyrazine?
The IUPAC name of 1-phenylphenanthrene;pyrazine (CID 175377735) is 1-phenylphenanthrene;pyrazine.
What is the SMILES notation for 1-phenylphenanthrene;pyrazine?
The canonical SMILES for 1-phenylphenanthrene;pyrazine is c1ccc(-c2cccc3c2ccc2ccccc23)cc1.c1cnccn1.
What is the InChIKey of 1-phenylphenanthrene;pyrazine?
The InChIKey is YEUWAOFWTBQGHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14.C4H4N2/c1-2-7-15(8-3-1)18-11-6-12-19-17-10-5-4-9-16(17)13-14-20(18)19;1-2-6-4-3-5-1/h1-14H;1-4H.
What are the key properties of 1-phenylphenanthrene;pyrazine?
1-phenylphenanthrene;pyrazine has a molecular weight of 334.42 g/mol, XLogP of 6.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylphenanthrene;pyrazine is sourced from PubChem (CID 175377735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).