C14H28N2O2 — CID 175378357
2,2-dimethylhexan-3-yl 2-methylpiperazine-1-carboxylate (PubChem CID 175378357) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2,2-dimethylhexan-3-yl 2-methylpiperazine-1-carboxylate.
| Compound Name | 2,2-dimethylhexan-3-yl 2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175378357 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2,2-dimethylhexan-3-yl 2-methylpiperazine-1-carboxylate |
| SMILES | CCCC(OC(=O)N1CCNCC1C)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O2/c1-6-7-12(14(3,4)5)18-13(17)16-9-8-15-10-11(16)2/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | WIQASNGIAMOPCG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |