About 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate
2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate (PubChem CID 175378403) has the molecular formula C14H16N4O2
and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate |
| PubChem CID | 175378403 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate |
| SMILES | [H]/N=C(/OC(=O)n1cnc(-c2ccccc2)n1)C(C)CC |
| InChI | InChI=1S/C14H16N4O2/c1-3-10(2)12(15)20-14(19)18-9-16-13(17-18)11-7-5-4-6-8-11/h4-10,15H,3H2,1-2H3/b15-12+ |
| InChIKey | GSMDYDMZDYHFBA-NTCAYCPXSA-N |
| XLogP | 2.95 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate?
The IUPAC name of 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate (CID 175378403) is 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate.
What is the SMILES notation for 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate?
The canonical SMILES for 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate is [H]/N=C(/OC(=O)n1cnc(-c2ccccc2)n1)C(C)CC.
What is the InChIKey of 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate?
The InChIKey is GSMDYDMZDYHFBA-NTCAYCPXSA-N. The full InChI is InChI=1S/C14H16N4O2/c1-3-10(2)12(15)20-14(19)18-9-16-13(17-18)11-7-5-4-6-8-11/h4-10,15H,3H2,1-2H3/b15-12+.
What are the key properties of 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate?
2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate has a molecular weight of 272.31 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutanimidoyl 3-phenyl-1,2,4-triazole-1-carboxylate is sourced from PubChem (CID 175378403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).