About (3-phenylphenyl)sulfanyl hydrogen carbonate
(3-phenylphenyl)sulfanyl hydrogen carbonate (PubChem CID 175378654) has the molecular formula C13H10O3S
and a molecular weight of 246.29 g/mol. Its IUPAC name is (3-phenylphenyl)sulfanyl hydrogen carbonate.
Molecular Properties
| Compound Name | (3-phenylphenyl)sulfanyl hydrogen carbonate |
| PubChem CID | 175378654 |
| Molecular Formula | C13H10O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | (3-phenylphenyl)sulfanyl hydrogen carbonate |
| SMILES | O=C(O)OSc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H10O3S/c14-13(15)16-17-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,(H,14,15) |
| InChIKey | RZHHZASMIKBGFP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-phenylphenyl)sulfanyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylphenyl)sulfanyl hydrogen carbonate?
The IUPAC name of (3-phenylphenyl)sulfanyl hydrogen carbonate (CID 175378654) is (3-phenylphenyl)sulfanyl hydrogen carbonate.
What is the SMILES notation for (3-phenylphenyl)sulfanyl hydrogen carbonate?
The canonical SMILES for (3-phenylphenyl)sulfanyl hydrogen carbonate is O=C(O)OSc1cccc(-c2ccccc2)c1.
What is the InChIKey of (3-phenylphenyl)sulfanyl hydrogen carbonate?
The InChIKey is RZHHZASMIKBGFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3S/c14-13(15)16-17-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,(H,14,15).
What are the key properties of (3-phenylphenyl)sulfanyl hydrogen carbonate?
(3-phenylphenyl)sulfanyl hydrogen carbonate has a molecular weight of 246.29 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylphenyl)sulfanyl hydrogen carbonate is sourced from PubChem (CID 175378654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).