C21H22FN4O4S- — CID 175378762
2-[3-[[4-[2-(2-ethoxyethoxy)-4-fluorophenyl]-1,3,5-triazin-2-yl]amino]phenyl]ethanesulfinate (PubChem CID 175378762) has the molecular formula C21H22FN4O4S- and a molecular weight of 445.50 g/mol. Its IUPAC name is 2-[3-[[4-[2-(2-ethoxyethoxy)-4-fluorophenyl]-1,3,5-triazin-2-yl]amino]phenyl]ethanesulfinate.
| Compound Name | 2-[3-[[4-[2-(2-ethoxyethoxy)-4-fluorophenyl]-1,3,5-triazin-2-yl]amino]phenyl]ethanesulfinate |
|---|---|
| PubChem CID | 175378762 |
| Molecular Formula | C21H22FN4O4S- |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-[3-[[4-[2-(2-ethoxyethoxy)-4-fluorophenyl]-1,3,5-triazin-2-yl]amino]phenyl]ethanesulfinate |
| SMILES | CCOCCOc1cc(F)ccc1-c1ncnc(Nc2cccc(CCS(=O)[O-])c2)n1 |
| InChI | InChI=1S/C21H23FN4O4S/c1-2-29-9-10-30-19-13-16(22)6-7-18(19)20-23-14-24-21(26-20)25-17-5-3-4-15(12-17)8-11-31(27)28/h3-7,12-14H,2,8-11H2,1H3,(H,27,28)(H,23,24,25,26)/p-1 |
| InChIKey | IVECMZPOMVJWFN-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|