About 2-(1,2,2-trifluoroethoxy)propanenitrile
2-(1,2,2-trifluoroethoxy)propanenitrile (PubChem CID 175378948) has the molecular formula C5H6F3NO
and a molecular weight of 153.10 g/mol. Its IUPAC name is 2-(1,2,2-trifluoroethoxy)propanenitrile.
Molecular Properties
| Compound Name | 2-(1,2,2-trifluoroethoxy)propanenitrile |
| PubChem CID | 175378948 |
| Molecular Formula | C5H6F3NO |
| Molecular Weight | 153.10 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 2-(1,2,2-trifluoroethoxy)propanenitrile |
| SMILES | CC(C#N)OC(F)C(F)F |
| InChI | InChI=1S/C5H6F3NO/c1-3(2-9)10-5(8)4(6)7/h3-5H,1H3 |
| InChIKey | YIFLEHGDQJULOD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.10 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,2,2-trifluoroethoxy)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,2-trifluoroethoxy)propanenitrile?
The IUPAC name of 2-(1,2,2-trifluoroethoxy)propanenitrile (CID 175378948) is 2-(1,2,2-trifluoroethoxy)propanenitrile.
What is the SMILES notation for 2-(1,2,2-trifluoroethoxy)propanenitrile?
The canonical SMILES for 2-(1,2,2-trifluoroethoxy)propanenitrile is CC(C#N)OC(F)C(F)F.
What is the InChIKey of 2-(1,2,2-trifluoroethoxy)propanenitrile?
The InChIKey is YIFLEHGDQJULOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F3NO/c1-3(2-9)10-5(8)4(6)7/h3-5H,1H3.
What are the key properties of 2-(1,2,2-trifluoroethoxy)propanenitrile?
2-(1,2,2-trifluoroethoxy)propanenitrile has a molecular weight of 153.10 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,2-trifluoroethoxy)propanenitrile is sourced from PubChem (CID 175378948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).