C15H17F15O4SSi — CID 175379697
2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-pentadecafluoro-2-(2-trimethoxysilylethyl)decanethioic S-acid (PubChem CID 175379697) has the molecular formula C15H17F15O4SSi and a molecular weight of 606.42 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-pentadecafluoro-2-(2-trimethoxysilylethyl)decanethioic S-acid.
| Compound Name | 2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-pentadecafluoro-2-(2-trimethoxysilylethyl)decanethioic S-acid |
|---|---|
| PubChem CID | 175379697 |
| Molecular Formula | C15H17F15O4SSi |
| Molecular Weight | 606.42 g/mol |
| Exact Mass | 606.04 |
| IUPAC Name | 2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-pentadecafluoro-2-(2-trimethoxysilylethyl)decanethioic S-acid |
| SMILES | CO[Si](CCC(F)(C(=O)S)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F)(OC)OC |
| InChI | InChI=1S/C15H17F15O4SSi/c1-32-36(33-2,34-3)5-4-10(20,9(31)35)12(23,24)14(27,28)15(29,30)13(25,26)11(21,22)7(17)6(16)8(18)19/h6-8H,4-5H2,1-3H3,(H,31,35) |
| InChIKey | XJAOUXXRHUTNFG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|