C21H30N4O6 — CID 175379759
methyl (2S)-2-[[tert-butyl(phenylmethoxycarbonylamino)carbamoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate (PubChem CID 175379759) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is methyl (2S)-2-[[tert-butyl(phenylmethoxycarbonylamino)carbamoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[[tert-butyl(phenylmethoxycarbonylamino)carbamoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 175379759 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl (2S)-2-[[tert-butyl(phenylmethoxycarbonylamino)carbamoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)N(NC(=O)OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H30N4O6/c1-21(2,3)25(24-20(29)31-13-14-8-6-5-7-9-14)19(28)23-16(18(27)30-4)12-15-10-11-22-17(15)26/h5-9,15-16H,10-13H2,1-4H3,(H,22,26)(H,23,28)(H,24,29)/t15-,16-/m0/s1 |
| InChIKey | QYTNHTNAFALIMR-HOTGVXAUSA-N |
| XLogP | 1.71 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|