C53H33Cl4N5 — CID 175380370
quinoline;10,12,13,23-tetrakis(4-chlorophenyl)-21H-porphyrin (PubChem CID 175380370) has the molecular formula C53H33Cl4N5 and a molecular weight of 881.69 g/mol. Its IUPAC name is quinoline;10,12,13,23-tetrakis(4-chlorophenyl)-21H-porphyrin.
| Compound Name | quinoline;10,12,13,23-tetrakis(4-chlorophenyl)-21H-porphyrin |
|---|---|
| PubChem CID | 175380370 |
| Molecular Formula | C53H33Cl4N5 |
| Molecular Weight | 881.69 g/mol |
| Exact Mass | 879.15 |
| IUPAC Name | quinoline;10,12,13,23-tetrakis(4-chlorophenyl)-21H-porphyrin |
| SMILES | Clc1ccc(-c2c(-c3ccc(Cl)cc3)c3c(-c4ccc(Cl)cc4)c4nc(cc5ccc(cc6nc(cc2n3-c2ccc(Cl)cc2)C=C6)[nH]5)C=C4)cc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C44H26Cl4N4.C9H7N/c45-29-7-1-26(2-8-29)41-39-22-19-36(51-39)24-35-16-15-33(49-35)23-34-17-18-37(50-34)25-40-42(27-3-9-30(46)10-4-27)43(28-5-11-31(47)12-6-28)44(41)52(40)38-20-13-32(48)14-21-38;1-2-6-9-8(4-1)5-3-7-10-9/h1-25,49H;1-7H/b33-23-,34-23-,35-24-,36-24-,37-25-,40-25-,41-39-,44-41-; |
| InChIKey | ABMVDISBWYPIKQ-WDLSFKHBSA-N |
| XLogP | 15.97 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.69 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |