C12H13NO — CID 175383228
N,2,3,4,5-pentamethylidenehept-6-enamide (PubChem CID 175383228) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is N,2,3,4,5-pentamethylidenehept-6-enamide.
| Compound Name | N,2,3,4,5-pentamethylidenehept-6-enamide |
|---|---|
| PubChem CID | 175383228 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | N,2,3,4,5-pentamethylidenehept-6-enamide |
| SMILES | C=CC(=C)C(=C)C(=C)C(=C)C(=O)N=C |
| InChI | InChI=1S/C12H13NO/c1-7-8(2)9(3)10(4)11(5)12(14)13-6/h7H,1-6H2 |
| InChIKey | VTAUIKVNKXVLGF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|