About 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide
2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide (PubChem CID 175383320) has the molecular formula C21H19N3O4S3
and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide |
| PubChem CID | 175383320 |
| Molecular Formula | C21H19N3O4S3 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)N(c2nc3ccccc3s2)S(=O)(=O)c2ccccc2CN)c1 |
| InChI | InChI=1S/C21H19N3O4S3/c1-15-7-6-9-17(13-15)30(25,26)24(21-23-18-10-3-4-11-19(18)29-21)31(27,28)20-12-5-2-8-16(20)14-22/h2-13H,14,22H2,1H3 |
| InChIKey | AUVUCLQRCNIZRO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide?
The IUPAC name of 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide (CID 175383320) is 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide.
What is the SMILES notation for 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide?
The canonical SMILES for 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide is Cc1cccc(S(=O)(=O)N(c2nc3ccccc3s2)S(=O)(=O)c2ccccc2CN)c1.
What is the InChIKey of 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide?
The InChIKey is AUVUCLQRCNIZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O4S3/c1-15-7-6-9-17(13-15)30(25,26)24(21-23-18-10-3-4-11-19(18)29-21)31(27,28)20-12-5-2-8-16(20)14-22/h2-13H,14,22H2,1H3.
What are the key properties of 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide?
2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide has a molecular weight of 473.60 g/mol, XLogP of 3.65, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N-(1,3-benzothiazol-2-yl)-N-(3-methylphenyl)sulfonylbenzenesulfonamide is sourced from PubChem (CID 175383320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).