C33H27ClN2O4 — CID 175383331
[2-[(7-benzyl-1-chloro-4-phenylmethoxyisoquinoline-3-carbonyl)amino]phenyl]methyl acetate (PubChem CID 175383331) has the molecular formula C33H27ClN2O4 and a molecular weight of 551.04 g/mol. Its IUPAC name is [2-[(7-benzyl-1-chloro-4-phenylmethoxyisoquinoline-3-carbonyl)amino]phenyl]methyl acetate.
| Compound Name | [2-[(7-benzyl-1-chloro-4-phenylmethoxyisoquinoline-3-carbonyl)amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 175383331 |
| Molecular Formula | C33H27ClN2O4 |
| Molecular Weight | 551.04 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | [2-[(7-benzyl-1-chloro-4-phenylmethoxyisoquinoline-3-carbonyl)amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccccc1NC(=O)c1nc(Cl)c2cc(Cc3ccccc3)ccc2c1OCc1ccccc1 |
| InChI | InChI=1S/C33H27ClN2O4/c1-22(37)39-21-26-14-8-9-15-29(26)35-33(38)30-31(40-20-24-12-6-3-7-13-24)27-17-16-25(19-28(27)32(34)36-30)18-23-10-4-2-5-11-23/h2-17,19H,18,20-21H2,1H3,(H,35,38) |
| InChIKey | XEDNKHMCCWTUFZ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.04 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|