C28H25F2N5O2 — CID 175383689
N-[[3-[4-(1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 175383689) has the molecular formula C28H25F2N5O2 and a molecular weight of 501.54 g/mol. Its IUPAC name is N-[[3-[4-(1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | N-[[3-[4-(1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 175383689 |
| Molecular Formula | C28H25F2N5O2 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | N-[[3-[4-(1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | ON=Cc1ncccc1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CCC4NCCOC4C3)c2c1 |
| InChI | InChI=1S/C28H25F2N5O2/c29-19-10-18(11-20(30)13-19)23-14-33-24-4-3-17(21-2-1-6-31-26(21)15-34-36)12-22(24)28(23)35-8-5-25-27(16-35)37-9-7-32-25/h1-4,6,10-15,25,27,32,36H,5,7-9,16H2 |
| InChIKey | WLAHXUMGOWUNSK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|