C12H24O6 — CID 175383809
5-hydroxy-2-(hydroxymethyl)-2-methylpentanoic acid;2-methylbutanoic acid (PubChem CID 175383809) has the molecular formula C12H24O6 and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-hydroxy-2-(hydroxymethyl)-2-methylpentanoic acid;2-methylbutanoic acid.
| Compound Name | 5-hydroxy-2-(hydroxymethyl)-2-methylpentanoic acid;2-methylbutanoic acid |
|---|---|
| PubChem CID | 175383809 |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 5-hydroxy-2-(hydroxymethyl)-2-methylpentanoic acid;2-methylbutanoic acid |
| SMILES | CC(CO)(CCCO)C(=O)O.CCC(C)C(=O)O |
| InChI | InChI=1S/C7H14O4.C5H10O2/c1-7(5-9,6(10)11)3-2-4-8;1-3-4(2)5(6)7/h8-9H,2-5H2,1H3,(H,10,11);4H,3H2,1-2H3,(H,6,7) |
| InChIKey | MXVRFLKZWAAQMO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |