C23H34O3 — CID 175384106
anisole;2-(5,5-dimethylhexan-2-yloxy)ethoxybenzene (PubChem CID 175384106) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is anisole;2-(5,5-dimethylhexan-2-yloxy)ethoxybenzene.
| Compound Name | anisole;2-(5,5-dimethylhexan-2-yloxy)ethoxybenzene |
|---|---|
| PubChem CID | 175384106 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | anisole;2-(5,5-dimethylhexan-2-yloxy)ethoxybenzene |
| SMILES | CC(CCC(C)(C)C)OCCOc1ccccc1.COc1ccccc1 |
| InChI | InChI=1S/C16H26O2.C7H8O/c1-14(10-11-16(2,3)4)17-12-13-18-15-8-6-5-7-9-15;1-8-7-5-3-2-4-6-7/h5-9,14H,10-13H2,1-4H3;2-6H,1H3 |
| InChIKey | MFLCJONVRUVVFN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|