C29H30F8N4O4 — CID 175384740
benzyl N-[(1S)-2-[2-amino-4-[1-(3,3-difluoroazetidin-1-yl)-3,4,4-trifluoro-1-oxobutan-2-yl]-3-fluoroanilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]carbamate (PubChem CID 175384740) has the molecular formula C29H30F8N4O4 and a molecular weight of 650.57 g/mol. Its IUPAC name is benzyl N-[(1S)-2-[2-amino-4-[1-(3,3-difluoroazetidin-1-yl)-3,4,4-trifluoro-1-oxobutan-2-yl]-3-fluoroanilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[(1S)-2-[2-amino-4-[1-(3,3-difluoroazetidin-1-yl)-3,4,4-trifluoro-1-oxobutan-2-yl]-3-fluoroanilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 175384740 |
| Molecular Formula | C29H30F8N4O4 |
| Molecular Weight | 650.57 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | benzyl N-[(1S)-2-[2-amino-4-[1-(3,3-difluoroazetidin-1-yl)-3,4,4-trifluoro-1-oxobutan-2-yl]-3-fluoroanilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]carbamate |
| SMILES | Nc1c(NC(=O)[C@@H](NC(=O)OCc2ccccc2)C2CCC(F)(F)CC2)ccc(C(C(=O)N2CC(F)(F)C2)C(F)C(F)F)c1F |
| InChI | InChI=1S/C29H30F8N4O4/c30-20-17(19(21(31)24(32)33)26(43)41-13-29(36,37)14-41)6-7-18(22(20)38)39-25(42)23(16-8-10-28(34,35)11-9-16)40-27(44)45-12-15-4-2-1-3-5-15/h1-7,16,19,21,23-24H,8-14,38H2,(H,39,42)(H,40,44)/t19?,21?,23-/m0/s1 |
| InChIKey | PWWPWBXAQLDYMT-IRSIHTCSSA-N |
| XLogP | 5.63 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|