About 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine
6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine (PubChem CID 175385034) has the molecular formula C10H11F2NO2
and a molecular weight of 215.20 g/mol. Its IUPAC name is 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine.
Molecular Properties
| Compound Name | 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine |
| PubChem CID | 175385034 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine |
| SMILES | CCc1ccc2c(c1N)COC(F)(F)O2 |
| InChI | InChI=1S/C10H11F2NO2/c1-2-6-3-4-8-7(9(6)13)5-14-10(11,12)15-8/h3-4H,2,5,13H2,1H3 |
| InChIKey | DNODODAFYIIZAW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine?
The IUPAC name of 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine (CID 175385034) is 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine.
What is the SMILES notation for 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine?
The canonical SMILES for 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine is CCc1ccc2c(c1N)COC(F)(F)O2.
What is the InChIKey of 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine?
The InChIKey is DNODODAFYIIZAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2/c1-2-6-3-4-8-7(9(6)13)5-14-10(11,12)15-8/h3-4H,2,5,13H2,1H3.
What are the key properties of 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine?
6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine has a molecular weight of 215.20 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,2-difluoro-4H-1,3-benzodioxin-5-amine is sourced from PubChem (CID 175385034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).