C7H4ClF7O — CID 175385234
5-chloro-1,3,4,5-tetrafluoro-4-(1,2,2-trifluoroethoxy)cyclopentene (PubChem CID 175385234) has the molecular formula C7H4ClF7O and a molecular weight of 272.55 g/mol. Its IUPAC name is 5-chloro-1,3,4,5-tetrafluoro-4-(1,2,2-trifluoroethoxy)cyclopentene.
| Compound Name | 5-chloro-1,3,4,5-tetrafluoro-4-(1,2,2-trifluoroethoxy)cyclopentene |
|---|---|
| PubChem CID | 175385234 |
| Molecular Formula | C7H4ClF7O |
| Molecular Weight | 272.55 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 5-chloro-1,3,4,5-tetrafluoro-4-(1,2,2-trifluoroethoxy)cyclopentene |
| SMILES | FC1=CC(F)C(F)(OC(F)C(F)F)C1(F)Cl |
| InChI | InChI=1S/C7H4ClF7O/c8-6(14)2(9)1-3(10)7(6,15)16-5(13)4(11)12/h1,3-5H |
| InChIKey | VCWLNUFZBUTDFB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|