About bis(2-(2,4-difluorophenyl)quinoline);iridium
bis(2-(2,4-difluorophenyl)quinoline);iridium (PubChem CID 175385280) has the molecular formula C30H18F4IrN2
and a molecular weight of 674.70 g/mol. Its IUPAC name is bis(2-(2,4-difluorophenyl)quinoline);iridium.
Molecular Properties
| Compound Name | bis(2-(2,4-difluorophenyl)quinoline);iridium |
| PubChem CID | 175385280 |
| Molecular Formula | C30H18F4IrN2 |
| Molecular Weight | 674.70 g/mol |
| Exact Mass | 675.10 |
| IUPAC Name | bis(2-(2,4-difluorophenyl)quinoline);iridium |
| SMILES | Fc1ccc(-c2ccc3ccccc3n2)c(F)c1.Fc1ccc(-c2ccc3ccccc3n2)c(F)c1.[Ir] |
| InChI | InChI=1S/2C15H9F2N.Ir/c2*16-11-6-7-12(13(17)9-11)15-8-5-10-3-1-2-4-14(10)18-15;/h2*1-9H; |
| InChIKey | OQXIGZOUPJYMLQ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 674.70 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2-(2,4-difluorophenyl)quinoline);iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(2,4-difluorophenyl)quinoline);iridium?
The IUPAC name of bis(2-(2,4-difluorophenyl)quinoline);iridium (CID 175385280) is bis(2-(2,4-difluorophenyl)quinoline);iridium.
What is the SMILES notation for bis(2-(2,4-difluorophenyl)quinoline);iridium?
The canonical SMILES for bis(2-(2,4-difluorophenyl)quinoline);iridium is Fc1ccc(-c2ccc3ccccc3n2)c(F)c1.Fc1ccc(-c2ccc3ccccc3n2)c(F)c1.[Ir].
What is the InChIKey of bis(2-(2,4-difluorophenyl)quinoline);iridium?
The InChIKey is OQXIGZOUPJYMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H9F2N.Ir/c2*16-11-6-7-12(13(17)9-11)15-8-5-10-3-1-2-4-14(10)18-15;/h2*1-9H;.
What are the key properties of bis(2-(2,4-difluorophenyl)quinoline);iridium?
bis(2-(2,4-difluorophenyl)quinoline);iridium has a molecular weight of 674.70 g/mol, XLogP of 8.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(2,4-difluorophenyl)quinoline);iridium is sourced from PubChem (CID 175385280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).