About [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate
[2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate (PubChem CID 175385825) has the molecular formula C28H28O5
and a molecular weight of 444.53 g/mol. Its IUPAC name is [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate |
| PubChem CID | 175385825 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate |
| SMILES | CC(C)c1ccc(C(=O)OC(OC(=O)c2ccc(C(C)C)cc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28O5/c1-18(2)20-10-14-23(15-11-20)26(30)32-28(25(29)22-8-6-5-7-9-22)33-27(31)24-16-12-21(13-17-24)19(3)4/h5-19,28H,1-4H3 |
| InChIKey | HBHYYZRMWOVWEP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate?
The IUPAC name of [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate (CID 175385825) is [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate.
What is the SMILES notation for [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate?
The canonical SMILES for [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate is CC(C)c1ccc(C(=O)OC(OC(=O)c2ccc(C(C)C)cc2)C(=O)c2ccccc2)cc1.
What is the InChIKey of [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate?
The InChIKey is HBHYYZRMWOVWEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28O5/c1-18(2)20-10-14-23(15-11-20)26(30)32-28(25(29)22-8-6-5-7-9-22)33-27(31)24-16-12-21(13-17-24)19(3)4/h5-19,28H,1-4H3.
What are the key properties of [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate?
[2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate has a molecular weight of 444.53 g/mol, XLogP of 6.16, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-phenyl-1-(4-propan-2-ylbenzoyl)oxyethyl] 4-propan-2-ylbenzoate is sourced from PubChem (CID 175385825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).