C29H44N2O6 — CID 175385859
(3S)-1-[3-[1-[3-(2,3-dihydroxypropylamino)propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]piperidine-3-carboxylic acid (PubChem CID 175385859) has the molecular formula C29H44N2O6 and a molecular weight of 516.68 g/mol. Its IUPAC name is (3S)-1-[3-[1-[3-(2,3-dihydroxypropylamino)propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[3-[1-[3-(2,3-dihydroxypropylamino)propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 175385859 |
| Molecular Formula | C29H44N2O6 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | (3S)-1-[3-[1-[3-(2,3-dihydroxypropylamino)propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccccc1C1=CC=CC(OCCCNCC(O)CO)(OCCCN2CCC[C@H](C(=O)O)C2)C1C |
| InChI | InChI=1S/C29H44N2O6/c1-22-9-3-4-11-26(22)27-12-5-13-29(23(27)2,36-17-7-14-30-19-25(33)21-32)37-18-8-16-31-15-6-10-24(20-31)28(34)35/h3-5,9,11-13,23-25,30,32-33H,6-8,10,14-21H2,1-2H3,(H,34,35)/t23?,24-,25?,29?/m0/s1 |
| InChIKey | VNZFXBZHQXLUDO-ZXWNJSKDSA-N |
| XLogP | 2.83 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|