C30H47N3O4 — CID 175385873
(3R)-1-[3-[1-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol (PubChem CID 175385873) has the molecular formula C30H47N3O4 and a molecular weight of 513.72 g/mol. Its IUPAC name is (3R)-1-[3-[1-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[3-[1-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 175385873 |
| Molecular Formula | C30H47N3O4 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.36 |
| IUPAC Name | (3R)-1-[3-[1-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]-6-methyl-5-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]oxypropyl]pyrrolidin-3-ol |
| SMILES | Cc1ccccc1C1=CC=CC(OCCCN2CCN(CCO)CC2)(OCCCN2CC[C@@H](O)C2)C1C |
| InChI | InChI=1S/C30H47N3O4/c1-25-8-3-4-9-28(25)29-10-5-12-30(26(29)2,37-23-7-14-33-15-11-27(35)24-33)36-22-6-13-31-16-18-32(19-17-31)20-21-34/h3-5,8-10,12,26-27,34-35H,6-7,11,13-24H2,1-2H3/t26?,27-,30?/m1/s1 |
| InChIKey | FZXVKAYWNBPUNU-AXOQCKABSA-N |
| XLogP | 2.77 |
| TPSA | 68.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|