About nitric acid;2-phenyl-1H-imidazole
nitric acid;2-phenyl-1H-imidazole (PubChem CID 175386038) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is nitric acid;2-phenyl-1H-imidazole.
Molecular Properties
| Compound Name | nitric acid;2-phenyl-1H-imidazole |
| PubChem CID | 175386038 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | nitric acid;2-phenyl-1H-imidazole |
| SMILES | O=[N+]([O-])O.c1ccc(-c2ncc[nH]2)cc1 |
| InChI | InChI=1S/C9H8N2.HNO3/c1-2-4-8(5-3-1)9-10-6-7-11-9;2-1(3)4/h1-7H,(H,10,11);(H,2,3,4) |
| InChIKey | LXJTYYHGADPPOR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitric acid;2-phenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitric acid;2-phenyl-1H-imidazole?
The IUPAC name of nitric acid;2-phenyl-1H-imidazole (CID 175386038) is nitric acid;2-phenyl-1H-imidazole.
What is the SMILES notation for nitric acid;2-phenyl-1H-imidazole?
The canonical SMILES for nitric acid;2-phenyl-1H-imidazole is O=[N+]([O-])O.c1ccc(-c2ncc[nH]2)cc1.
What is the InChIKey of nitric acid;2-phenyl-1H-imidazole?
The InChIKey is LXJTYYHGADPPOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.HNO3/c1-2-4-8(5-3-1)9-10-6-7-11-9;2-1(3)4/h1-7H,(H,10,11);(H,2,3,4).
What are the key properties of nitric acid;2-phenyl-1H-imidazole?
nitric acid;2-phenyl-1H-imidazole has a molecular weight of 207.19 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitric acid;2-phenyl-1H-imidazole is sourced from PubChem (CID 175386038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).