C23H32ClF2IN6 — CID 175387420
5-chloro-6-(2,6-difluoro-4-iodophenyl)-N-(3,3-dimethylbutan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine;3,3-dimethylbutan-2-amine (PubChem CID 175387420) has the molecular formula C23H32ClF2IN6 and a molecular weight of 592.90 g/mol. Its IUPAC name is 5-chloro-6-(2,6-difluoro-4-iodophenyl)-N-(3,3-dimethylbutan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine;3,3-dimethylbutan-2-amine.
| Compound Name | 5-chloro-6-(2,6-difluoro-4-iodophenyl)-N-(3,3-dimethylbutan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine;3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 175387420 |
| Molecular Formula | C23H32ClF2IN6 |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 5-chloro-6-(2,6-difluoro-4-iodophenyl)-N-(3,3-dimethylbutan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine;3,3-dimethylbutan-2-amine |
| SMILES | CC(N)C(C)(C)C.CC(Nc1c(-c2c(F)cc(I)cc2F)c(Cl)nc2ncnn12)C(C)(C)C |
| InChI | InChI=1S/C17H17ClF2IN5.C6H15N/c1-8(17(2,3)4)24-15-13(12-10(19)5-9(21)6-11(12)20)14(18)25-16-22-7-23-26(15)16;1-5(7)6(2,3)4/h5-8,24H,1-4H3;5H,7H2,1-4H3 |
| InChIKey | PFCHQGOLXIJUKO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.90 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|