About 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride
1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride (PubChem CID 175387525) has the molecular formula C11H15Cl
and a molecular weight of 182.69 g/mol. Its IUPAC name is 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride.
Molecular Properties
| Compound Name | 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride |
| PubChem CID | 175387525 |
| Molecular Formula | C11H15Cl |
| Molecular Weight | 182.69 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride |
| SMILES | C=CCc1cccc(C)c1C.Cl |
| InChI | InChI=1S/C11H14.ClH/c1-4-6-11-8-5-7-9(2)10(11)3;/h4-5,7-8H,1,6H2,2-3H3;1H |
| InChIKey | NDUFXZOEFBHFJZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride?
The IUPAC name of 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride (CID 175387525) is 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride.
What is the SMILES notation for 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride?
The canonical SMILES for 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride is C=CCc1cccc(C)c1C.Cl.
What is the InChIKey of 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride?
The InChIKey is NDUFXZOEFBHFJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14.ClH/c1-4-6-11-8-5-7-9(2)10(11)3;/h4-5,7-8H,1,6H2,2-3H3;1H.
What are the key properties of 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride?
1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride has a molecular weight of 182.69 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3-prop-2-enylbenzene;hydrochloride is sourced from PubChem (CID 175387525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).