C25H29BrN4O3 — CID 175387977
tert-butyl 3-[[4-(4-bromo-2-methoxyphenyl)phthalazin-1-yl]amino]piperidine-1-carboxylate (PubChem CID 175387977) has the molecular formula C25H29BrN4O3 and a molecular weight of 513.44 g/mol. Its IUPAC name is tert-butyl 3-[[4-(4-bromo-2-methoxyphenyl)phthalazin-1-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(4-bromo-2-methoxyphenyl)phthalazin-1-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175387977 |
| Molecular Formula | C25H29BrN4O3 |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | tert-butyl 3-[[4-(4-bromo-2-methoxyphenyl)phthalazin-1-yl]amino]piperidine-1-carboxylate |
| SMILES | COc1cc(Br)ccc1-c1nnc(NC2CCCN(C(=O)OC(C)(C)C)C2)c2ccccc12 |
| InChI | InChI=1S/C25H29BrN4O3/c1-25(2,3)33-24(31)30-13-7-8-17(15-30)27-23-19-10-6-5-9-18(19)22(28-29-23)20-12-11-16(26)14-21(20)32-4/h5-6,9-12,14,17H,7-8,13,15H2,1-4H3,(H,27,29) |
| InChIKey | YYOMPIRVIXVATN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |