C8H11N7 — CID 175388860
3-piperazin-1-yl-7H-imidazo[4,5-e][1,2,4]triazine (PubChem CID 175388860) has the molecular formula C8H11N7 and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-piperazin-1-yl-7H-imidazo[4,5-e][1,2,4]triazine.
| Compound Name | 3-piperazin-1-yl-7H-imidazo[4,5-e][1,2,4]triazine |
|---|---|
| PubChem CID | 175388860 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-piperazin-1-yl-7H-imidazo[4,5-e][1,2,4]triazine |
| SMILES | c1nc2nc(N3CCNCC3)nnc2[nH]1 |
| InChI | InChI=1S/C8H11N7/c1-3-15(4-2-9-1)8-12-6-7(13-14-8)11-5-10-6/h5,9H,1-4H2,(H,10,11,12,13,14) |
| InChIKey | HIUOZBYAWAFIOV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |