C30H24ClF6N7O7S — CID 175388942
[1-[3-[3-[acetyl(methylsulfonyl)amino]-4-chloro-1-methylindazol-7-yl]-4-oxo-7-(2,2,3,3-tetrafluoropropoxy)pyrido[2,3-d]pyrimidin-2-yl]-2-(3,5-difluorophenyl)ethyl] carbamate (PubChem CID 175388942) has the molecular formula C30H24ClF6N7O7S and a molecular weight of 776.07 g/mol. Its IUPAC name is [1-[3-[3-[acetyl(methylsulfonyl)amino]-4-chloro-1-methylindazol-7-yl]-4-oxo-7-(2,2,3,3-tetrafluoropropoxy)pyrido[2,3-d]pyrimidin-2-yl]-2-(3,5-difluorophenyl)ethyl] carbamate.
| Compound Name | [1-[3-[3-[acetyl(methylsulfonyl)amino]-4-chloro-1-methylindazol-7-yl]-4-oxo-7-(2,2,3,3-tetrafluoropropoxy)pyrido[2,3-d]pyrimidin-2-yl]-2-(3,5-difluorophenyl)ethyl] carbamate |
|---|---|
| PubChem CID | 175388942 |
| Molecular Formula | C30H24ClF6N7O7S |
| Molecular Weight | 776.07 g/mol |
| Exact Mass | 775.11 |
| IUPAC Name | [1-[3-[3-[acetyl(methylsulfonyl)amino]-4-chloro-1-methylindazol-7-yl]-4-oxo-7-(2,2,3,3-tetrafluoropropoxy)pyrido[2,3-d]pyrimidin-2-yl]-2-(3,5-difluorophenyl)ethyl] carbamate |
| SMILES | CC(=O)N(c1nn(C)c2c(-n3c(C(Cc4cc(F)cc(F)c4)OC(N)=O)nc4nc(OCC(F)(F)C(F)F)ccc4c3=O)ccc(Cl)c12)S(C)(=O)=O |
| InChI | InChI=1S/C30H24ClF6N7O7S/c1-13(45)44(52(3,48)49)26-22-18(31)5-6-19(23(22)42(2)41-26)43-25(20(51-29(38)47)10-14-8-15(32)11-16(33)9-14)40-24-17(27(43)46)4-7-21(39-24)50-12-30(36,37)28(34)35/h4-9,11,20,28H,10,12H2,1-3H3,(H2,38,47) |
| InChIKey | BQUVUBPASAIAHV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 181.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.07 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|