About 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane
2-(2,2-dichloroethylsilyl)ethyl-diethylsilane (PubChem CID 175390063) has the molecular formula C8H20Cl2Si2
and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane.
Molecular Properties
| Compound Name | 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane |
| PubChem CID | 175390063 |
| Molecular Formula | C8H20Cl2Si2 |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane |
| SMILES | CC[SiH](CC)CC[SiH2]CC(Cl)Cl |
| InChI | InChI=1S/C8H20Cl2Si2/c1-3-12(4-2)6-5-11-7-8(9)10/h8,12H,3-7,11H2,1-2H3 |
| InChIKey | LYGSADWVYVPPGN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane?
The IUPAC name of 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane (CID 175390063) is 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane.
What is the SMILES notation for 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane?
The canonical SMILES for 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane is CC[SiH](CC)CC[SiH2]CC(Cl)Cl.
What is the InChIKey of 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane?
The InChIKey is LYGSADWVYVPPGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20Cl2Si2/c1-3-12(4-2)6-5-11-7-8(9)10/h8,12H,3-7,11H2,1-2H3.
What are the key properties of 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane?
2-(2,2-dichloroethylsilyl)ethyl-diethylsilane has a molecular weight of 243.33 g/mol, XLogP of 3.06, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dichloroethylsilyl)ethyl-diethylsilane is sourced from PubChem (CID 175390063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).