About 3-(2,2-difluoroethylamino)but-2-enoic acid
3-(2,2-difluoroethylamino)but-2-enoic acid (PubChem CID 175390128) has the molecular formula C6H9F2NO2
and a molecular weight of 165.14 g/mol. Its IUPAC name is 3-(2,2-difluoroethylamino)but-2-enoic acid.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethylamino)but-2-enoic acid |
| PubChem CID | 175390128 |
| Molecular Formula | C6H9F2NO2 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 3-(2,2-difluoroethylamino)but-2-enoic acid |
| SMILES | CC(=CC(=O)O)NCC(F)F |
| InChI | InChI=1S/C6H9F2NO2/c1-4(2-6(10)11)9-3-5(7)8/h2,5,9H,3H2,1H3,(H,10,11) |
| InChIKey | DXSMOCWVOGCDHZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoroethylamino)but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethylamino)but-2-enoic acid?
The IUPAC name of 3-(2,2-difluoroethylamino)but-2-enoic acid (CID 175390128) is 3-(2,2-difluoroethylamino)but-2-enoic acid.
What is the SMILES notation for 3-(2,2-difluoroethylamino)but-2-enoic acid?
The canonical SMILES for 3-(2,2-difluoroethylamino)but-2-enoic acid is CC(=CC(=O)O)NCC(F)F.
What is the InChIKey of 3-(2,2-difluoroethylamino)but-2-enoic acid?
The InChIKey is DXSMOCWVOGCDHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2NO2/c1-4(2-6(10)11)9-3-5(7)8/h2,5,9H,3H2,1H3,(H,10,11).
What are the key properties of 3-(2,2-difluoroethylamino)but-2-enoic acid?
3-(2,2-difluoroethylamino)but-2-enoic acid has a molecular weight of 165.14 g/mol, XLogP of 0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethylamino)but-2-enoic acid is sourced from PubChem (CID 175390128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).