About (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate
(5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate (PubChem CID 175391117) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate.
Molecular Properties
| Compound Name | (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate |
| PubChem CID | 175391117 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate |
| SMILES | Cc1ccc2[nH]cc(OC(N)=O)c2n1 |
| InChI | InChI=1S/C9H9N3O2/c1-5-2-3-6-8(12-5)7(4-11-6)14-9(10)13/h2-4,11H,1H3,(H2,10,13) |
| InChIKey | XBTTUSCJTZIBTA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate?
The IUPAC name of (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate (CID 175391117) is (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate.
What is the SMILES notation for (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate?
The canonical SMILES for (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate is Cc1ccc2[nH]cc(OC(N)=O)c2n1.
What is the InChIKey of (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate?
The InChIKey is XBTTUSCJTZIBTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-5-2-3-6-8(12-5)7(4-11-6)14-9(10)13/h2-4,11H,1H3,(H2,10,13).
What are the key properties of (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate?
(5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate has a molecular weight of 191.19 g/mol, XLogP of 1.33, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl) carbamate is sourced from PubChem (CID 175391117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).