C21H15F3N2O2 — CID 175391763
2-amino-9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-7-carbonitrile (PubChem CID 175391763) has the molecular formula C21H15F3N2O2 and a molecular weight of 384.36 g/mol. Its IUPAC name is 2-amino-9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-7-carbonitrile.
| Compound Name | 2-amino-9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-7-carbonitrile |
|---|---|
| PubChem CID | 175391763 |
| Molecular Formula | C21H15F3N2O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-amino-9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-7-carbonitrile |
| SMILES | COc1cc(C#N)c2ccc3c(c2c1)CC(N)C(c1cc(F)c(F)cc1F)O3 |
| InChI | InChI=1S/C21H15F3N2O2/c1-27-11-4-10(9-25)12-2-3-20-14(13(12)5-11)7-19(26)21(28-20)15-6-17(23)18(24)8-16(15)22/h2-6,8,19,21H,7,26H2,1H3 |
| InChIKey | YNBBDBMVYLTYFK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|