C32H35ClFN9OS — CID 175391864
1-(2-chlorophenyl)-1-[[2-[4-[[4-(cyclohexylmethylamino)-6-[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]phenyl]acetyl]amino]thiourea (PubChem CID 175391864) has the molecular formula C32H35ClFN9OS and a molecular weight of 648.21 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-1-[[2-[4-[[4-(cyclohexylmethylamino)-6-[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]phenyl]acetyl]amino]thiourea.
| Compound Name | 1-(2-chlorophenyl)-1-[[2-[4-[[4-(cyclohexylmethylamino)-6-[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]phenyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 175391864 |
| Molecular Formula | C32H35ClFN9OS |
| Molecular Weight | 648.21 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | 1-(2-chlorophenyl)-1-[[2-[4-[[4-(cyclohexylmethylamino)-6-[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]phenyl]acetyl]amino]thiourea |
| SMILES | NC(=S)N(NC(=O)Cc1ccc(Nc2nc(NCc3ccc(F)cc3)nc(NCC3CCCCC3)n2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C32H35ClFN9OS/c33-26-8-4-5-9-27(26)43(29(35)45)42-28(44)18-21-12-16-25(17-13-21)38-32-40-30(36-19-22-6-2-1-3-7-22)39-31(41-32)37-20-23-10-14-24(34)15-11-23/h4-5,8-17,22H,1-3,6-7,18-20H2,(H2,35,45)(H,42,44)(H3,36,37,38,39,40,41) |
| InChIKey | UXTYKDCEGJKEFV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.21 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|