C28H16N4 — CID 175392116
5,12-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11,13-octaene;5,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene (PubChem CID 175392116) has the molecular formula C28H16N4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 5,12-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11,13-octaene;5,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene.
| Compound Name | 5,12-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11,13-octaene;5,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene |
|---|---|
| PubChem CID | 175392116 |
| Molecular Formula | C28H16N4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 5,12-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11,13-octaene;5,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene |
| SMILES | c1cc2ccc3ccnc4ccc(n1)c2c34.c1cc2ccc3nccc4ccc(n1)c2c43 |
| InChI | InChI=1S/2C14H8N2/c1-3-11-14-10(6-8-15-11)2-4-12-13(14)9(1)5-7-16-12;1-2-10-6-8-16-12-4-3-11-13(14(10)12)9(1)5-7-15-11/h2*1-8H |
| InChIKey | RUSIVPIKRJKCKG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|