C28H41NO5Si — CID 175392713
ethyl 2-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 175392713) has the molecular formula C28H41NO5Si and a molecular weight of 499.72 g/mol. Its IUPAC name is ethyl 2-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | ethyl 2-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 175392713 |
| Molecular Formula | C28H41NO5Si |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | ethyl 2-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCOC(=O)C(NC(=O)OC(C)(C)C)(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C28H41NO5Si/c1-10-32-24(30)28(21(2)3,29-25(31)33-26(4,5)6)34-35(27(7,8)9,22-17-13-11-14-18-22)23-19-15-12-16-20-23/h11-21H,10H2,1-9H3,(H,29,31) |
| InChIKey | UVMCIZRTNCLLAO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|