C18H21FN6O3 — CID 175392787
2-[7-(3-fluoropropoxy)-1-oxo-4-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl]-N-pyrimidin-4-ylacetamide (PubChem CID 175392787) has the molecular formula C18H21FN6O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-[7-(3-fluoropropoxy)-1-oxo-4-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl]-N-pyrimidin-4-ylacetamide.
| Compound Name | 2-[7-(3-fluoropropoxy)-1-oxo-4-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl]-N-pyrimidin-4-ylacetamide |
|---|---|
| PubChem CID | 175392787 |
| Molecular Formula | C18H21FN6O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[7-(3-fluoropropoxy)-1-oxo-4-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl]-N-pyrimidin-4-ylacetamide |
| SMILES | CC(C)c1nn(CC(=O)Nc2ccncn2)c(=O)c2cc(OCCCF)cn12 |
| InChI | InChI=1S/C18H21FN6O3/c1-12(2)17-23-25(10-16(26)22-15-4-6-20-11-21-15)18(27)14-8-13(9-24(14)17)28-7-3-5-19/h4,6,8-9,11-12H,3,5,7,10H2,1-2H3,(H,20,21,22,26) |
| InChIKey | DCWZOZFDXICYHG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|