About but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate
but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate (PubChem CID 175393012) has the molecular formula C11H21NO4
and a molecular weight of 231.29 g/mol. Its IUPAC name is but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate.
Molecular Properties
| Compound Name | but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate |
| PubChem CID | 175393012 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate |
| SMILES | C=CC(C)OC(=O)N(CC)CC(OC)OC |
| InChI | InChI=1S/C11H21NO4/c1-6-9(3)16-11(13)12(7-2)8-10(14-4)15-5/h6,9-10H,1,7-8H2,2-5H3 |
| InChIKey | MWCKLODBPQEZJG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate?
The IUPAC name of but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate (CID 175393012) is but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate.
What is the SMILES notation for but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate?
The canonical SMILES for but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate is C=CC(C)OC(=O)N(CC)CC(OC)OC.
What is the InChIKey of but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate?
The InChIKey is MWCKLODBPQEZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4/c1-6-9(3)16-11(13)12(7-2)8-10(14-4)15-5/h6,9-10H,1,7-8H2,2-5H3.
What are the key properties of but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate?
but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate has a molecular weight of 231.29 g/mol, XLogP of 1.64, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-yl N-(2,2-dimethoxyethyl)-N-ethylcarbamate is sourced from PubChem (CID 175393012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).