About copper(1+);trifluoroborane;fluoride
copper(1+);trifluoroborane;fluoride (PubChem CID 175393171) has the molecular formula BCuF4
and a molecular weight of 150.35 g/mol. Its IUPAC name is copper(1+);trifluoroborane;fluoride.
Molecular Properties
| Compound Name | copper(1+);trifluoroborane;fluoride |
| PubChem CID | 175393171 |
| Molecular Formula | BCuF4 |
| Molecular Weight | 150.35 g/mol |
| Exact Mass | 149.93 |
| IUPAC Name | copper(1+);trifluoroborane;fluoride |
| SMILES | FB(F)F.[Cu+].[F-] |
| InChI | InChI=1S/BF3.Cu.FH/c2-1(3)4;;/h;;1H/q;+1;/p-1 |
| InChIKey | HPKVZKUKWNHEGN-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.35 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);trifluoroborane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);trifluoroborane;fluoride?
The IUPAC name of copper(1+);trifluoroborane;fluoride (CID 175393171) is copper(1+);trifluoroborane;fluoride.
What is the SMILES notation for copper(1+);trifluoroborane;fluoride?
The canonical SMILES for copper(1+);trifluoroborane;fluoride is FB(F)F.[Cu+].[F-].
What is the InChIKey of copper(1+);trifluoroborane;fluoride?
The InChIKey is HPKVZKUKWNHEGN-UHFFFAOYSA-M. The full InChI is InChI=1S/BF3.Cu.FH/c2-1(3)4;;/h;;1H/q;+1;/p-1.
What are the key properties of copper(1+);trifluoroborane;fluoride?
copper(1+);trifluoroborane;fluoride has a molecular weight of 150.35 g/mol, XLogP of -2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);trifluoroborane;fluoride is sourced from PubChem (CID 175393171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).