About ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate
ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate (PubChem CID 175393587) has the molecular formula C23H23FN2O3
and a molecular weight of 394.45 g/mol. Its IUPAC name is ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate |
| PubChem CID | 175393587 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)c1cc2c(=O)n(-c3cc(C)cc(C)c3)c(CC)nc2cc1F |
| InChI | InChI=1S/C23H23FN2O3/c1-6-21-25-20-12-19(24)17(15(5)23(28)29-7-2)11-18(20)22(27)26(21)16-9-13(3)8-14(4)10-16/h8-12H,5-7H2,1-4H3 |
| InChIKey | LJFGMMBYZKYCTG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate?
The IUPAC name of ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate (CID 175393587) is ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate.
What is the SMILES notation for ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate?
The canonical SMILES for ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate is C=C(C(=O)OCC)c1cc2c(=O)n(-c3cc(C)cc(C)c3)c(CC)nc2cc1F.
What is the InChIKey of ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate?
The InChIKey is LJFGMMBYZKYCTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN2O3/c1-6-21-25-20-12-19(24)17(15(5)23(28)29-7-2)11-18(20)22(27)26(21)16-9-13(3)8-14(4)10-16/h8-12H,5-7H2,1-4H3.
What are the key properties of ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate?
ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate has a molecular weight of 394.45 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(3,5-dimethylphenyl)-2-ethyl-7-fluoro-4-oxoquinazolin-6-yl]prop-2-enoate is sourced from PubChem (CID 175393587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).