C18H11Cl2FN2O3 — CID 175393607
3-[3-(2,6-dichlorophenyl)-7-fluoro-2-methyl-4-oxoquinazolin-6-yl]prop-2-enoic acid (PubChem CID 175393607) has the molecular formula C18H11Cl2FN2O3 and a molecular weight of 393.20 g/mol. Its IUPAC name is 3-[3-(2,6-dichlorophenyl)-7-fluoro-2-methyl-4-oxoquinazolin-6-yl]prop-2-enoic acid.
| Compound Name | 3-[3-(2,6-dichlorophenyl)-7-fluoro-2-methyl-4-oxoquinazolin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175393607 |
| Molecular Formula | C18H11Cl2FN2O3 |
| Molecular Weight | 393.20 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 3-[3-(2,6-dichlorophenyl)-7-fluoro-2-methyl-4-oxoquinazolin-6-yl]prop-2-enoic acid |
| SMILES | Cc1nc2cc(F)c(C=CC(=O)O)cc2c(=O)n1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H11Cl2FN2O3/c1-9-22-15-8-14(21)10(5-6-16(24)25)7-11(15)18(26)23(9)17-12(19)3-2-4-13(17)20/h2-8H,1H3,(H,24,25) |
| InChIKey | PZBRSJGBDHEZFA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|