About 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid
3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid (PubChem CID 175394498) has the molecular formula C12H16Cl2NO8PS2
and a molecular weight of 468.27 g/mol. Its IUPAC name is 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid.
Molecular Properties
| Compound Name | 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid |
| PubChem CID | 175394498 |
| Molecular Formula | C12H16Cl2NO8PS2 |
| Molecular Weight | 468.27 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid |
| SMILES | CCOP(=S)(OCC)Oc1nc(S(=O)(=O)OCCC(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2NO8PS2/c1-3-20-24(25,21-4-2)23-11-8(13)7-9(14)12(15-11)26(18,19)22-6-5-10(16)17/h7H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | FDJPFKONNPQJIQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid?
The IUPAC name of 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid (CID 175394498) is 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid.
What is the SMILES notation for 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid?
The canonical SMILES for 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid is CCOP(=S)(OCC)Oc1nc(S(=O)(=O)OCCC(=O)O)c(Cl)cc1Cl.
What is the InChIKey of 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid?
The InChIKey is FDJPFKONNPQJIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Cl2NO8PS2/c1-3-20-24(25,21-4-2)23-11-8(13)7-9(14)12(15-11)26(18,19)22-6-5-10(16)17/h7H,3-6H2,1-2H3,(H,16,17).
What are the key properties of 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid?
3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid has a molecular weight of 468.27 g/mol, XLogP of 3.24, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfonyloxy]propanoic acid is sourced from PubChem (CID 175394498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).